
CAS 721958-61-8
:6-Fluorospiro[2H-1-benzopyran-2,4′-piperidin]-4(3H)-one
Description:
6-Fluorospiro[2H-1-benzopyran-2,4′-piperidin]-4(3H)-one is a synthetic organic compound characterized by its unique spirocyclic structure, which combines a benzopyran moiety with a piperidinone. The presence of a fluorine atom at the 6-position of the benzopyran ring enhances its biological activity and lipophilicity, potentially influencing its pharmacological properties. This compound typically exhibits a range of chemical properties, including solubility in organic solvents and stability under standard laboratory conditions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. The spiro configuration may contribute to its ability to interact with biological targets, making it of interest in drug discovery. Additionally, the compound's CAS number, 721958-61-8, allows for easy identification and reference in chemical databases. Overall, 6-Fluorospiro[2H-1-benzopyran-2,4′-piperidin]-4(3H)-one represents a class of compounds that may offer valuable insights into structure-activity relationships in pharmacology.
Formula:C13H14FNO2
InChI:InChI=1S/C13H14FNO2/c14-9-1-2-12-10(7-9)11(16)8-13(17-12)3-5-15-6-4-13/h1-2,7,15H,3-6,8H2
InChI key:InChIKey=VIDRCVJKHNBSPC-UHFFFAOYSA-N
SMILES:O=C1CC2(OC=3C1=CC(F)=CC3)CCNCC2
Synonyms:- Spiro[2H-1-benzopyran-2,4′-piperidin]-4(3H)-one, 6-fluoro-
- 6-Fluorospiro[2H-1-benzopyran-2,4′-piperidin]-4(3H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.