CymitQuimica logo

CAS 721958-73-2

:

Methyl 3-amino-4-[2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethoxy]-2-butenoate

Description:
Methyl 3-amino-4-[2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethoxy]-2-butenoate, with the CAS number 721958-73-2, is a synthetic organic compound characterized by its complex structure, which includes an amino group, a butenoate moiety, and a dioxo-isoindole derivative. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups like the amino and ester functionalities. The presence of the dioxo-isoindole structure may impart unique biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. As with many synthetic organic compounds, its stability, reactivity, and biological activity would depend on various factors, including pH, temperature, and the presence of other chemical species. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C15H16N2O5
InChI:InChI=1S/C15H16N2O5/c1-21-13(18)8-10(16)9-22-7-6-17-14(19)11-4-2-3-5-12(11)15(17)20/h2-5,8H,6-7,9,16H2,1H3
InChI key:InChIKey=HLBWWPLQGTYAKL-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CCOCC(=CC(OC)=O)N)=CC=CC2
Synonyms:
  • 2-Butenoic acid, 3-amino-4-[2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethoxy]-, methyl ester
  • Methyl 3-amino-4-[2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethoxy]-2-butenoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.