CAS 721970-24-7

N-(3-amino-1-naphthyl)acetamide

Description:

N-(3-amino-1-naphthyl)acetamide is an organic compound characterized by its naphthalene-derived structure, which features an amino group and an acetamide functional group. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the amine and amide functionalities. It exhibits properties such as potential biological activity, making it of interest in medicinal chemistry and drug development. The amino group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the naphthalene ring contributes to its aromatic stability and may affect its electronic properties. The compound's synthesis often involves the acylation of an amino-substituted naphthalene derivative, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity. Overall, N-(3-amino-1-naphthyl)acetamide is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₂H₁₂N₂O

InChI: InChI=1/C12H12N2O/c1-8(15)14-12-7-10(13)6-9-4-2-3-5-11(9)12/h2-7H,13H2,1H3,(H,14,15)

SMILES: CC(=Nc1cc(cc2ccccc12)N)O

1-Acetamido-3-aminonaphthalene

CAS: 721970-24-7

1-Acetamido-3-aminonaphthalene

Formula: C₁₂H₁₂N₂O

Purity: ≥95%

Color and Shape: Powder

Molecular weight: 200.24g/mol

Ref: 54-OR2139