CymitQuimica logo

CAS 72198-15-3

:

3-Chloro-α,4-dihydroxybenzeneacetic acid

Description:
3-Chloro-α,4-dihydroxybenzeneacetic acid, with the CAS number 72198-15-3, is a chemical compound characterized by its aromatic structure and the presence of both chlorine and hydroxyl functional groups. This compound features a chlorinated benzene ring, which contributes to its reactivity and potential biological activity. The presence of two hydroxyl groups indicates that it may exhibit phenolic properties, which can influence its solubility and interaction with other molecules. The acetic acid moiety suggests that it can participate in acid-base reactions and may have applications in pharmaceuticals or as a biochemical probe. Its structural characteristics may also impart specific pharmacokinetic properties, such as absorption and metabolism. Additionally, the chlorine substituent can enhance the compound's lipophilicity, potentially affecting its bioavailability. Overall, 3-Chloro-α,4-dihydroxybenzeneacetic acid is of interest in various fields, including medicinal chemistry and environmental science, due to its unique structural features and potential applications.
Formula:C8H7ClO4
InChI:InChI=1S/C8H7ClO4/c9-5-3-4(1-2-6(5)10)7(11)8(12)13/h1-3,7,10-11H,(H,12,13)
InChI key:InChIKey=VDBWQCRJTMKEMJ-UHFFFAOYSA-N
SMILES:C(C(O)=O)(O)C1=CC(Cl)=C(O)C=C1
Synonyms:
  • 3-Chloro-4-hydroxymandelic acid
  • Benzeneacetic acid, 3-chloro-α,4-dihydroxy-
  • 3-Chloro-α,4-dihydroxybenzeneacetic acid
  • 2-(3-Chloro-4-hydroxyphenyl)-2-hydroxyacetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.