CAS 7220-79-3: Methylene blue trihydrate
Description:Methylene blue trihydrate, with the CAS number 7220-79-3, is a synthetic dye and a heterocyclic aromatic compound. It appears as a dark blue crystalline solid and is soluble in water, forming a blue solution. This compound is known for its ability to act as a redox indicator and has applications in various fields, including biology, medicine, and chemistry. In biological contexts, it is often used as a staining agent in microscopy and as a treatment for methemoglobinemia, a condition where hemoglobin is unable to effectively release oxygen to tissues. Methylene blue trihydrate exhibits properties such as being a cationic dye, which allows it to bind to negatively charged cellular components. Additionally, it has photodynamic properties, making it useful in certain therapeutic applications. The trihydrate form indicates that three water molecules are associated with each molecule of methylene blue, influencing its solubility and stability. Overall, methylene blue trihydrate is a versatile compound with significant utility in scientific and medical applications.
Formula:C16H18N3S·Cl·3H2O
InChI:InChI=1S/C16H18N3S.ClH.3H2O/c1-18(2)11-5-7-13-15(9-11)20-16-10-12(19(3)4)6-8-14(16)17-13;;;;/h5-10H,1-4H3;1H;3*1H2/q+1;;;;/p-1
InChI key:InChIKey=XQAXGZLFSSPBMK-UHFFFAOYSA-M
SMILES:[Cl-].O.N=1C2=CC=C(C=C2[S+]=C3C=C(C=CC13)N(C)C)N(C)C
- Synonyms:
- 3,7-Bis(dimethylamino)phenazathionium chloride trihydrate
- Methylene blue trihydrate
- Phenothiazin-5-ium, 3,7-bis(dimethylamino)-, chloride, hydrate (1:1:3)
- Methyltltioninium Chloride
- Phenothiazin-5-ium, 3,7-bis(dimethylamino)-, chloride, trihydrate
- C.I. Basic Blue 9, trihydrate
