CAS 72204-44-5
:(R)-Cyano(3-phenoxyphenyl)methyl (1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate
Description:
(R)-Cyano(3-phenoxyphenyl)methyl (1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate, with CAS number 72204-44-5, is a chemical compound that belongs to the class of cyclopropanecarboxylates. This substance is characterized by its complex molecular structure, which includes a cyano group, a phenoxyphenyl moiety, and a dichloroethenyl substituent. The presence of these functional groups suggests potential applications in agrochemicals, particularly as an insecticide or herbicide, due to the biological activity often associated with such compounds. The stereochemistry indicated by the (R) and (S) designations suggests that the compound exhibits chirality, which can influence its biological interactions and efficacy. Additionally, the presence of halogen atoms, such as chlorine, may enhance the compound's stability and lipophilicity, affecting its environmental persistence and bioavailability. Overall, this compound's unique structural features contribute to its potential utility in various chemical applications, particularly in the field of crop protection.
Formula:C22H19Cl2NO3
InChI:InChI=1S/C22H19Cl2NO3/c1-22(2)17(12-19(23)24)20(22)21(26)28-18(13-25)14-7-6-10-16(11-14)27-15-8-4-3-5-9-15/h3-12,17-18,20H,1-2H3/t17-,18+,20-/m1/s1
InChI key:InChIKey=KAATUXNTWXVJKI-WSTZPKSXSA-N
SMILES:C(O[C@@H](C#N)C1=CC(OC2=CC=CC=C2)=CC=C1)(=O)[C@H]3[C@@H](C=C(Cl)Cl)C3(C)C
Synonyms:- (R)-Cyano(3-phenoxyphenyl)methyl (1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate
- Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (R)-cyano(3-phenoxyphenyl)methyl ester, (1S,3S)-
- Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, cyano(3-phenoxyphenyl)methyl ester, [1S-[1α(S*),3α]]-
- Ru 28001
- alpha-Cyano-3-phenoxybenzyl (1S-(1alpha(S*),3alpha))-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(1S,2S,1'R)-Cypermethrin
CAS:Controlled ProductFormula:C22H19Cl2NO3Color and Shape:NeatMolecular weight:416.297

