CAS 72207-80-8
:Oxirane, 2-(chloromethyl)-, reaction products with polyethylene glycol
Description:
Oxirane, 2-(chloromethyl)-, reaction products with polyethylene glycol, identified by CAS number 72207-80-8, is a chemical compound formed through the reaction of chloromethyl oxirane with polyethylene glycol. This substance typically exhibits characteristics associated with both its oxirane (epoxide) and polyethylene glycol components. It is likely to be a viscous liquid or solid, depending on the molecular weight of the polyethylene glycol used in the reaction. The presence of the oxirane group suggests that it may participate in further chemical reactions, particularly those involving nucleophiles, due to its strained three-membered ring structure. The chloromethyl group can also enhance reactivity, allowing for potential applications in polymer chemistry and as a cross-linking agent. Additionally, the polyethylene glycol component contributes to the compound's solubility in water and other polar solvents, making it useful in various formulations, including surfactants and emulsifiers. Overall, this compound's unique structure imparts a combination of reactivity and solubility, making it valuable in industrial and research applications.
Formula:(C3H5ClO·(C2H4O)nH2O)x
InChI:InChI=1S/C3H5ClO.C2H6O2/c4-1-3-2-5-3;3-1-2-4/h3H,1-2H2;3-4H,1-2H2
InChI key:InChIKey=HRRFUVNAWMTOGH-UHFFFAOYSA-N
SMILES:C(Cl)C1CO1.C(CO[H])O
Synonyms:- (Chloromethyl)-Oxiran Reaction Products With Polyethylene Glycol
- Oxirane, (chloromethyl)-, reaction products with polyethylene glycol
- Oxirane, 2-(chloromethyl)-, reaction products with polyethylene glycol
- Polyethylene glycol, epichlorohydrin reaction product
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
