CAS 72209-20-2
:(3aS,4R,6S,6aR)-4-(6-amino-2-chloro-purin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxylic acid
Description:
The chemical substance with the name "(3aS,4R,6S,6aR)-4-(6-amino-2-chloro-purin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxylic acid" and CAS number "72209-20-2" is a complex organic compound characterized by its unique structural features, including a fused dioxole ring system and a purine derivative. This compound exhibits chirality, indicated by its specific stereochemical configuration at multiple centers, which can influence its biological activity and interactions. The presence of an amino group and a chloro substituent suggests potential reactivity and biological significance, particularly in medicinal chemistry. The carboxylic acid functional group contributes to its acidity and solubility properties, which are important for its behavior in biological systems. Overall, this compound may have applications in pharmaceuticals or biochemistry, particularly in the context of nucleic acid interactions or as a potential therapeutic agent, although specific biological activities would require further investigation.
Formula:C13H14ClN5O5
InChI:InChI=1/C13H14ClN5O5/c1-13(2)23-5-6(24-13)10(22-7(5)11(20)21)19-3-16-4-8(15)17-12(14)18-9(4)19/h3,5-7,10H,1-2H3,(H,20,21)(H2,15,17,18)/t5-,6+,7+,10-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Chloroadenosine-5'-carboxy-2',3'-acetonide
CAS:Controlled ProductApplications 2-Chloroadenosine-5’-carboxy-2’,3’-acetonide (cas# 72209-20-2) is a compound useful in organic synthesis.
Formula:C13H14ClN5O5Color and Shape:NeatMolecular weight:355.735'-Carboxy-2-chloro-2'-3'-O-isopropylideneadenosine
CAS:5'-Carboxy-2-chloro-2'-3'-O-isopropylideneadenosine is a monophosphate nucleoside that inhibits viral replication by inhibiting the synthesis of both DNA and RNA. This compound is used to treat cancers such as leukemia, lymphoma, and multiple myeloma. It also has antiviral properties that are active against herpes simplex virus (HSV) and human cytomegalovirus (CMV). 5'-Carboxy-2-chloro-2'-3'-O-isopropylideneadenosine is a modified nucleoside with a phosphoramidite group on the 2' position of the ribose sugar.Formula:C13H14ClN5O5Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:355.74 g/mol


