CAS 7221-27-4
:4-amino-3,5-dinitrobenzoic acid
Description:
4-Amino-3,5-dinitrobenzoic acid, with the CAS number 7221-27-4, is an organic compound characterized by the presence of an amino group and two nitro groups attached to a benzoic acid structure. This compound typically appears as a yellow crystalline solid and is known for its relatively high solubility in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid and amino functional groups. The nitro groups contribute to its electron-withdrawing properties, which can influence its reactivity and stability. 4-Amino-3,5-dinitrobenzoic acid is often utilized in various chemical syntheses and as an intermediate in the production of dyes and pharmaceuticals. It is important to handle this compound with care, as nitro compounds can be sensitive to heat and shock, and may pose environmental and health risks if not managed properly. Overall, its unique functional groups make it a valuable compound in organic chemistry and industrial applications.
Formula:C7H5N3O6
InChI:InChI=1/C7H5N3O6/c8-6-4(9(13)14)1-3(7(11)12)2-5(6)10(15)16/h1-2H,8H2,(H,11,12)
SMILES:c1c(cc(c(c1N(=O)=O)N)N(=O)=O)C(=O)O
Synonyms:- Benzoic Acid, 4-Amino-3,5-Dinitro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Amino-3,5-dinitrobenzoic acid
CAS:<p>4-Amino-3,5-dinitrobenzoic acid (4ADBA) is a reactive chemical compound with acidic properties. It reacts with nucleophiles to form diazo compounds, which are used in analytical methods for the detection of amines and phenols. 4ADBA can be used to measure the concentration of aspirin in pharmaceutical formulations. The reaction is linear over a wide range of concentrations and has an optimal reaction time of 10 minutes at pH 2.0–2.5. The half-life values for 4ADBA are approximately 3 hours at pH 3 and 7 hours at pH 5.</p>Formula:C7H5N3O6Purity:Min. 95%Color and Shape:SolidMolecular weight:227.13 g/mol
