CAS 7221-31-0
:2-(4-Nitroanilino)benzoic acid
Description:
2-(4-Nitroanilino)benzoic acid, with the CAS number 7221-31-0, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety and a 4-nitroaniline substituent. This compound typically appears as a solid and is known for its potential applications in dye chemistry and as a pH indicator due to its acidic functional group. The presence of the nitro group contributes to its electronic properties, making it a useful intermediate in organic synthesis. It is generally soluble in organic solvents but may have limited solubility in water, depending on the pH. The compound exhibits characteristic UV-Vis absorption properties, which can be utilized in spectroscopic analyses. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 2-(4-Nitroanilino)benzoic acid is a valuable compound in various chemical applications, particularly in research and development settings.
Formula:C13H10N2O4
InChI:InChI=1S/C13H10N2O4/c16-13(17)11-3-1-2-4-12(11)14-9-5-7-10(8-6-9)15(18)19/h1-8,14H,(H,16,17)
InChI key:InChIKey=ZZPQUGLIFJZPGU-UHFFFAOYSA-N
SMILES:N(C1=C(C(O)=O)C=CC=C1)C2=CC=C(N(=O)=O)C=C2
Synonyms:- Anthranilic acid, N-(p-nitrophenyl)-
- 4-Nitro-2′-diphenylaminecarboxylic acid
- N-(4-Nitrophenyl)anthranilic acid
- Benzoic acid, 2-[(4-nitrophenyl)amino]-
- 2-[(4-Nitrophenyl)amino]benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
