CAS 72216-04-7
:2-(2-Fluorophenyl)-pyrrolidine
Description:
2-(2-Fluorophenyl)-pyrrolidine is an organic compound characterized by its pyrrolidine ring, which is a five-membered saturated nitrogen-containing heterocycle. The presence of a 2-fluorophenyl group indicates that a fluorine atom is substituted on the second carbon of a phenyl ring, which is attached to the pyrrolidine. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the nitrogen atom in the pyrrolidine ring, which can participate in various chemical reactions. The fluorine substituent can influence the compound's electronic properties, potentially affecting its reactivity and interaction with biological systems. As a result, 2-(2-Fluorophenyl)-pyrrolidine may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, where modifications to the molecular structure can lead to variations in biological activity. Its specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or reference to chemical databases for precise values.
Formula:C10H12FN
InChI:InChI=1/C10H12FN/c11-10-4-2-1-3-9(10)8-5-6-12-7-8/h1-4,8,12H,5-7H2
SMILES:c1ccc(c(c1)C1CCNC1)F
Synonyms:- 3-(2-Fluorophenyl)Pyrrolidine
- 2-(2-Fluorophenyl)pyrrolidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(2-Fluorophenyl)pyrrolidine, 95%
CAS:<p>2-(2-Fluorophenyl)pyrrolidine is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may ref</p>Formula:C10H12FNPurity:95%Molecular weight:165.212-(2-Fluorophenyl)pyrrolidine
CAS:Formula:C10H12FNPurity:98%Color and Shape:LiquidMolecular weight:165.20742-(2-Fluorophenyl)pyrrolidine
CAS:2-(2-Fluorophenyl)pyrrolidinePurity:97%Molecular weight:165.21g/mol2-(2-Fluorophenyl)pyrrolidine
CAS:Controlled Product<p>Stability Hygroscopic<br>Applications 2-(2-Fluorophenyl)pyrrolidine<br></p>Formula:C10H12FNColor and Shape:NeatMolecular weight:165.21



