CAS 72216-08-1
:3,4-Dihydro-5-[4-(trifluoromethyl)phenyl]-2H-pyrrole
Description:
3,4-Dihydro-5-[4-(trifluoromethyl)phenyl]-2H-pyrrole, identified by its CAS number 72216-08-1, is a heterocyclic organic compound featuring a pyrrole ring structure. This compound is characterized by the presence of a trifluoromethyl group attached to a phenyl ring, which significantly influences its chemical properties and reactivity. The trifluoromethyl group is known for imparting unique electronic characteristics, enhancing lipophilicity, and affecting the compound's biological activity. The dihydropyrrole structure contributes to its potential as a building block in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound may exhibit interesting physical properties such as solubility in organic solvents and stability under various conditions. Its synthesis typically involves multi-step organic reactions, and it may be utilized in various applications, including agrochemicals and materials science. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C11H10F3N
InChI:InChI=1S/C11H10F3N/c12-11(13,14)9-5-3-8(4-6-9)10-2-1-7-15-10/h3-6H,1-2,7H2
InChI key:InChIKey=CQWLAMBVONGCJI-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC=C(C=C1)C=2CCCN2
Synonyms:- 2H-pyrrole
- 2H-pyrrole, 3,4-dihydro-5-[4-(trifluoromethyl)phenyl]-
- 3,4-Dihydro-5-[4-(trifluoromethyl)phenyl]-2H-pyrrole
- 5-(4-Trifluoromethyl-phenyl)-3,4-dihydro
- 5-[4-(Trifluoromethyl)phenyl]-3,4-dihydro-2H-pyrrole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.