CAS 72218-68-9
:2'-Bromo-2'-deoxyuridine
Description:
2'-Bromo-2'-deoxyuridine (BrdU) is a synthetic nucleoside analog of thymidine, characterized by the substitution of a bromine atom at the 2' position of the deoxyribose sugar. It is commonly used in molecular biology and biochemistry as a tool for studying DNA synthesis and cell proliferation. BrdU can be incorporated into newly synthesized DNA in place of thymidine during DNA replication, allowing researchers to label and track dividing cells. This compound is often detected using immunohistochemical techniques, where antibodies specific to BrdU are employed to visualize its incorporation in tissues or cell cultures. BrdU exhibits properties such as solubility in water and organic solvents, making it versatile for various experimental applications. Additionally, it has been studied for its potential roles in cancer research and therapeutic applications, as it can influence cellular processes. However, caution is advised due to its potential mutagenic effects, which necessitate careful handling and consideration in experimental design.
Formula:C9H11BrN2O5
InChI:InChI=1/C9H11BrN2O5/c10-6-7(15)4(3-13)17-8(6)12-2-1-5(14)11-9(12)16/h1-2,4,6-8,13,15H,3H2,(H,11,14,16)/t4-,6-,7-,8-/m1/s1
SMILES:c1cn([C@H]2[C@@H]([C@@H]([C@@H](CO)O2)O)Br)c(=O)nc1O
Synonyms:- 1-[(2R,3R,4R,5R)-3-Bromo-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Uridine,2'-(bromo-82Br)-2'-deoxy- (9CI)
CAS:Formula:C9H11BrN2O5Purity:98%Color and Shape:SolidMolecular weight:307.09802'-Bromo-2'-deoxyuridine, 98%
CAS:2'-Bromo-2'-deoxyuridine is a thymidine analogue which is incorporated into DNA. 5-BrdU is routinely and extensively used to measure DNA synthesis and to label dividing cells. Consequently 5-BrdU is used to study cell signaling and other processes that induce cell proliferation. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Formula:C9H11BrN2O5Purity:98%Molecular weight:307.1


