CymitQuimica logo

CAS 72218-74-7

:

(5E)-2-amino-5-[ethoxy(hydroxy)methylidene]-1,3-thiazol-4(5H)-one

Description:
(5E)-2-amino-5-[ethoxy(hydroxy)methylidene]-1,3-thiazol-4(5H)-one is a chemical compound characterized by its thiazole ring structure, which is a five-membered heterocyclic ring containing sulfur and nitrogen. This compound features an amino group, an ethoxy group, and a hydroxy-substituted methylidene moiety, contributing to its reactivity and potential biological activity. The presence of the thiazole ring often indicates potential pharmacological properties, as thiazoles are commonly found in various bioactive compounds. The compound's structure suggests it may participate in hydrogen bonding due to the hydroxy group, influencing its solubility and interaction with biological targets. Additionally, the ethoxy group may enhance lipophilicity, affecting its absorption and distribution in biological systems. Overall, this compound's unique functional groups and heterocyclic framework make it of interest in medicinal chemistry and drug development, although specific biological activities would require further investigation through experimental studies.
Formula:C6H8N2O3S
InChI:InChI=1/C6H8N2O3S/c1-2-11-5(10)3-4(9)8-6(7)12-3/h10H,2H2,1H3,(H2,7,8,9)/b5-3+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.