CAS 72221-03-5
:2-Methyl-2-(1-methylethyl)oxirane
Description:
2-Methyl-2-(1-methylethyl)oxirane, also known as a type of epoxide, is a cyclic ether characterized by a three-membered ring structure containing an oxygen atom. This compound features a branched alkyl group, specifically an isopropyl group, attached to the carbon adjacent to the epoxide oxygen. Its molecular formula typically reflects the presence of carbon, hydrogen, and oxygen atoms, contributing to its unique properties. As an epoxide, it exhibits high reactivity due to the strained ring structure, making it a useful intermediate in organic synthesis, particularly in the production of various polymers and fine chemicals. The compound is generally colorless and may have a faint odor. It is important to handle it with care, as epoxides can be irritants and may pose health risks upon exposure. Additionally, its reactivity allows it to participate in various chemical reactions, including ring-opening reactions with nucleophiles, which can lead to the formation of a wide range of derivatives.
Formula:C6H12O
InChI:InChI=1S/C6H12O/c1-5(2)6(3)4-7-6/h5H,4H2,1-3H3
InChI key:InChIKey=JATXAMXFNMUGBL-UHFFFAOYSA-N
SMILES:C(C)(C)C1(C)CO1
Synonyms:- 1,2-Epoxy-2,3-dimethylbutane
- 2,3-Dimethyl-1-butene oxide
- 2-Methyl-2-(1-methylethyl)oxirane
- 2-Methyl-2-(Propan-2-Yl)Oxirane
- Butane, 1,2-epoxy-2,3-dimethyl-
- Oxirane, 2-methyl-2-(1-methylethyl)-
- 2-Isopropyl-2-methyloxirane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.