CAS 72224-25-0
:4-(2-Oxiranylmethoxy)benzeneacetic acid
Description:
4-(2-Oxiranylmethoxy)benzeneacetic acid, identified by its CAS number 72224-25-0, is a chemical compound that features a benzene ring substituted with both an acetic acid group and an epoxide (oxirane) moiety. This structure suggests that the compound possesses both aromatic and aliphatic characteristics, which can influence its reactivity and interactions. The presence of the epoxide group indicates potential for ring-opening reactions, making it a reactive species in organic synthesis. The carboxylic acid functional group contributes to its acidity and can participate in hydrogen bonding, enhancing solubility in polar solvents. Additionally, the methoxy group can influence the electronic properties of the molecule, potentially affecting its biological activity. Overall, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry and related fields. Its unique structure allows for diverse applications, particularly in the development of new therapeutic agents or as intermediates in organic synthesis.
Formula:C11H12O4
InChI:InChI=1S/C11H12O4/c12-11(13)5-8-1-3-9(4-2-8)14-6-10-7-15-10/h1-4,10H,5-7H2,(H,12,13)
InChI key:InChIKey=PAYGWDOCZMSKLL-UHFFFAOYSA-N
SMILES:O(CC1CO1)C2=CC=C(CC(O)=O)C=C2
Synonyms:- 4-(2-Oxiranylmethoxy)benzeneacetic acid
- 2-[4-[(Oxiran-2-yl)methoxy]phenyl]acetic acid
- Benzeneacetic acid, 4-(oxiranylmethoxy)-, (±)-
- Benzeneacetic acid, 4-(2-oxiranylmethoxy)-
- Benzeneacetic acid, 4-(oxiranylmethoxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-{4-[(Oxiran-2-yl)methoxy]phenyl}acetic acid
CAS:2-{4-[(Oxiran-2-yl)methoxy]phenyl}acetic acidFormula:C11H12O4Purity:95%Molecular weight:208.212-(4-(Oxiran-2-ylmethoxy)phenyl)acetic acid
CAS:Formula:C11H12O4Purity:95%Color and Shape:SolidMolecular weight:208.21064-(2,3-Epoxypropoxy)phenylacetic Acid
CAS:Controlled ProductFormula:C11H12O4Color and Shape:NeatMolecular weight:208.214-(2,3-Epoxypropoxy)phenylacetic Acid
CAS:Formula:C11H12O4Color and Shape:NeatMolecular weight:208.212-{4-[(Oxiran-2-yl)methoxy]phenyl}acetic acid
CAS:2-{4-[(Oxiran-2-yl)methoxy]phenyl}acetic acid is an organic compound with the chemical formula CH3COCH2CH=OCH2C6H5. This white solid is a derivative of phenylacetic acid. It is used as a building block for the synthesis of esters, amides, and other derivatives. It can also be used to synthesize epoxides and amines by epoxidation or amine, respectively. 2-{4-[(Oxiran-2-yl)methoxy]phenyl}acetic acid has been shown to inhibit the growth of Pseudomonas aeruginosa and Staphylococcus aureus isolates. The ester group on this molecule may contribute to its anti-bacterial activity.Formula:C11H12O4Purity:Min. 95%Molecular weight:208.21 g/mol





