CAS 72229-09-5

Methyl 2-hexylcyclopropanecarboxylate

Description:

Methyl 2-hexylcyclopropanecarboxylate is an organic compound characterized by its ester functional group, which is derived from the carboxylic acid and alcohol components. This compound features a cyclopropane ring, contributing to its unique structural properties and potential reactivity. The presence of a hexyl group enhances its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. Methyl 2-hexylcyclopropanecarboxylate may exhibit interesting biological activities, which could be explored for applications in pharmaceuticals or agrochemicals. Its molecular structure suggests potential for various chemical reactions, including esterification and hydrolysis. Additionally, the compound's stability and reactivity can be influenced by the steric effects of the cyclopropane and hexyl groups. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, Methyl 2-hexylcyclopropanecarboxylate represents a versatile compound within organic chemistry, with implications for both research and industrial applications.

Formula: C₁₁H₂₀O₂

InChI: InChI=1S/C11H20O2/c1-3-4-5-6-7-9-8-10(9)11(12)13-2/h9-10H,3-8H2,1-2H3

InChI key: InChIKey=XUNYOLFFGUIJSI-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1C(CCCCCC)C1

Synonyms:

• 1-Hexyl-2-methoxycarbonylcyclopropan
• Methyl 2-hexylcyclopropanecarboxylate
• Cyclopropanecarboxylic acid, 2-hexyl-, methyl ester
• 2-Hexylcyclopropanecarboxylic acid methyl ester