CAS 72229-33-5

(3aR,4R,6E,8S,10E,11aR)-4,8-dihydroxy-6,10-dimethyl-3-methylene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one

Description:

The chemical substance with the name "(3aR,4R,6E,8S,10E,11aR)-4,8-dihydroxy-6,10-dimethyl-3-methylene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one" and CAS number "72229-33-5" is a complex organic compound characterized by its unique bicyclic structure, which includes multiple stereocenters contributing to its specific three-dimensional configuration. This compound features hydroxyl groups at the 4 and 8 positions, indicating its potential for hydrogen bonding and solubility in polar solvents. The presence of double bonds in the cyclodeca structure suggests it may exhibit reactivity typical of unsaturated compounds, potentially participating in various chemical reactions such as addition or oxidation. Its molecular framework suggests it could be of interest in fields such as medicinal chemistry or natural product synthesis, where such structural motifs are often associated with biological activity. Additionally, the stereochemistry indicated by the R and S designations may influence its interaction with biological systems, making it a candidate for further study in pharmacological applications.

Formula: C₁₅H₂₀O₄

InChI: InChI=1/C15H20O4/c1-8-4-11(16)5-9(2)7-13-14(12(17)6-8)10(3)15(18)19-13/h4,7,11-14,16-17H,3,5-6H2,1-2H3/b8-4+,9-7+/t11-,12-,13-,14-/m1/s1

2-Hydroxyeupatolide

CAS: 72229-33-5

2-Hydroxyeupatolide is anti-inflammatory, blocking NF-κB pathways, aiding understanding of Eupatorium plant pharmaceuticals.

Formula: C₁₅H₂₀O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 264.32

Ref: TM-TN1212

2-α-Hydroxyeupatolide

CAS: 72229-33-5

Formula: C₁₅H₂₀O₄

Purity: 95%~99%

Molecular weight: 264.321

Ref: BP-BP0048

2-Hydroxyeupatolide

CAS: 72229-33-5

2-Hydroxyeupatolide is a naturally occurring sesquiterpene lactone, which is derived from various plants including those in the Asteraceae family. This compound exhibits its mode of action by modulating key signaling pathways and inhibiting NF-kB, a transcription factor involved in inflammatory responses. Additionally, 2-Hydroxyeupatolide interferes with cell proliferation and induces apoptosis, particularly in cancer cells, through its interaction with cellular oxidative stress mechanisms and mitochondrial pathways.

Formula: C₁₅H₂₀O₄

Purity: Min. 95%

Molecular weight: 264.32 g/mol

Ref: 3D-XCA22933