CymitQuimica logo

CAS 72229-40-4

:

Linustatin

Description:
Linustatin is a naturally occurring compound classified as a cyanogenic glycoside, primarily found in certain plant species, particularly in the seeds of flax (Linum usitatissimum). Its chemical structure features a glucose moiety linked to a cyanogenic aglycone, which can release hydrogen cyanide upon hydrolysis, making it potentially toxic in high concentrations. Linustatin is known for its role in plant defense mechanisms, deterring herbivores and pathogens. In terms of solubility, it is generally soluble in water, which facilitates its biological activity. The compound has garnered interest in research due to its potential health benefits, including antioxidant properties and its role in metabolic processes. However, due to its cyanogenic nature, consumption of linustatin-containing materials should be approached with caution, as improper processing can lead to the release of toxic cyanide. Overall, linustatin exemplifies the complex interplay between plant chemistry and ecological interactions, highlighting both its potential benefits and risks.
Formula:C16H27NO11
InChI:InChI=1/C16H27NO11/c1-16(2,5-17)28-15-13(24)11(22)9(20)7(27-15)4-25-14-12(23)10(21)8(19)6(3-18)26-14/h6-15,18-24H,3-4H2,1-2H3/t6-,7-,8-,9-,10+,11+,12-,13-,14-,15+/m1/s1
InChI key:InChIKey=FERSMFQBWVBKQK-CXTTVELOSA-N
SMILES:C(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@H]2O[C@@H](OC(C#N)(C)C)[C@H](O)[C@@H](O)[C@@H]2O
Synonyms:
  • Linustatin
  • 2-[(6-O-β-D-Glucopyranosyl-β-D-glucopyranosyl)oxy]-2-methylpropanenitrile
  • Propanenitrile, 2-[(6-O-β-D-glucopyranosyl-β-D-glucopyranosyl)oxy]-2-methyl-
  • See more synonyms
Found 8 products.