
CAS 7223-44-1
:1-(1,1-Dimethyl-2-propyn-1-yl)pyrrolidine
Description:
1-(1,1-Dimethyl-2-propyn-1-yl)pyrrolidine, with the CAS number 7223-44-1, is an organic compound characterized by its unique structure that combines a pyrrolidine ring with a substituted alkyne group. The presence of the 1,1-dimethyl-2-propynyl moiety contributes to its distinctive chemical properties, including potential reactivity due to the alkyne functionality. This compound is typically a colorless to pale yellow liquid, exhibiting a relatively low boiling point and moderate solubility in organic solvents. Its molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and additions, making it of interest in synthetic organic chemistry. Additionally, the presence of the pyrrolidine ring may impart certain biological activities, which could be relevant in medicinal chemistry. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, 1-(1,1-Dimethyl-2-propyn-1-yl)pyrrolidine is a compound of interest for both academic research and potential industrial applications.
Formula:C9H15N
InChI:InChI=1S/C9H15N/c1-4-9(2,3)10-7-5-6-8-10/h1H,5-8H2,2-3H3
InChI key:InChIKey=ZQIGMZVYUIHTIC-UHFFFAOYSA-N
SMILES:C(C#C)(C)(C)N1CCCC1
Synonyms:- 1-(1,1-Dimethyl-2-propyn-1-yl)pyrrolidine
- 1-(1,1-Dimethyl-2-propynyl)-pyrrolidine
- Pyrrolidine, 1-(1,1-dimethyl-2-propynyl)-
- 1-(2-Methylbut-3-yn-2-yl)pyrrolidine
- Pyrrolidine, 1-(1,1-dimethyl-2-propyn-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.