
CAS 72235-42-8
:3-Chloro-1,8-naphthyridin-4-amine
Description:
3-Chloro-1,8-naphthyridin-4-amine is a heterocyclic organic compound characterized by its naphthyridine structure, which consists of a fused bicyclic system containing nitrogen atoms. The presence of a chlorine atom at the 3-position and an amino group at the 4-position contributes to its chemical reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in polar solvents and may have varying solubility in non-polar solvents, depending on the specific conditions. It is often used in medicinal chemistry and drug development due to its potential as a pharmacophore, which can interact with biological targets. The compound may also exhibit properties such as fluorescence or UV absorbance, making it useful in analytical applications. Additionally, its structure allows for various substitution reactions, which can be exploited to synthesize derivatives with enhanced properties. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H6ClN3
InChI:InChI=1S/C8H6ClN3/c9-6-4-12-8-5(7(6)10)2-1-3-11-8/h1-4H,(H2,10,11,12)
InChI key:InChIKey=WQKMEBVGBFBHNH-UHFFFAOYSA-N
SMILES:NC=1C2=C(N=CC1Cl)N=CC=C2
Synonyms:- 1,8-Naphthyridin-4-amine, 3-chloro-
- 3-Chloro-1,8-naphthyridin-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.