CAS 72235-51-9
:2,3-difluorobenzylamine
Description:
2,3-Difluorobenzylamine is an organic compound characterized by the presence of an amine functional group attached to a benzyl group that is further substituted with two fluorine atoms at the 2 and 3 positions of the benzene ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its moderate polarity due to the presence of the amine group, which can engage in hydrogen bonding. The fluorine substituents enhance the compound's reactivity and influence its physical properties, such as boiling and melting points, making it more lipophilic compared to its non-fluorinated counterparts. 2,3-Difluorobenzylamine is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for synthesizing more complex molecules. Safety data indicates that, like many amines, it should be handled with care, as it may be irritating to the skin and eyes.
Formula:C7H7F2N
InChI:InChI=1/C7H7F2N/c8-6-3-1-2-5(4-10)7(6)9/h1-3H,4,10H2/p+1
Synonyms:- Difluorobenzylamine1
- 2,3-Difluorobenzyamine
- 1-(2,3-Difluorophenyl)Methanamine
- (2,3-Difluorophenyl)Methanaminium
- 2,3-Difluorobenzyl amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(2,3-Difluorophenyl)methanamine
CAS:Formula:C7H7F2NPurity:95%Color and Shape:LiquidMolecular weight:143.13402,3-Difluorobenzylamine
CAS:2,3-DifluorobenzylamineFormula:C7H7F2NPurity:98%Color and Shape: faint yellow. with needlelike solid liquidMolecular weight:143.13398g/mol2,3-Difluorobenzylamine
CAS:Formula:C7H7F2NPurity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:143.142,3-Difluorobenzyl amine
CAS:2,3-Difluorobenzyl amine is a versatile building block that is used in the synthesis of complex organic compounds. It is a high quality reagent and can be used as a reaction component. 2,3-Difluorobenzyl amine can be synthesized from 3-fluoroaniline and difluoroacetic acid using a nitrite salt as the oxidant. The reaction yields the desired product in good yield with no side products.Formula:C7H7F2NPurity:Min. 95%Color and Shape:Colorless PowderMolecular weight:143.13 g/mol




