CAS 7224-61-5
:1,9-dihydroxy-2,10-dimethoxy-6,6-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolinium
Description:
1,9-Dihydroxy-2,10-dimethoxy-6,6-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolinium, with CAS number 7224-61-5, is a complex organic compound characterized by its unique polycyclic structure, which includes a dibenzoquinolinium framework. This compound features multiple functional groups, including hydroxyl (-OH) and methoxy (-OCH3) groups, contributing to its chemical reactivity and potential biological activity. The presence of dimethyl groups enhances its hydrophobic character, which may influence its solubility and interaction with biological membranes. The tetrahydro configuration indicates that it has a saturated portion, which can affect its stability and reactivity. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its synthesis and characterization typically involve advanced organic synthesis techniques, and it may be studied for its potential applications in various fields, including pharmaceuticals and materials science. As with many organic compounds, its behavior in different solvents and under varying conditions can provide insights into its reactivity and potential uses.
Formula:C20H24NO4
InChI:InChI=1/C20H23NO4/c1-21(2)6-5-11-9-17(25-4)20(23)19-13-10-16(24-3)15(22)8-12(13)7-14(21)18(11)19/h8-10,14H,5-7H2,1-4H3,(H-,22,23)/p+1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Laurifoline
CAS:Laurifoline is a bioactive alkaloid, which is derived from certain plant species, primarily within the Lauraceae family. It is known for its diverse pharmacological activities, including anti-inflammatory, anti-cancer, and neuroprotective effects. The mode of action of laurifoline involves interaction with various cellular pathways, influencing processes such as cell proliferation, apoptosis, and the modulation of neurotransmitter systems. This makes it a compound of significant interest in pharmacological research.
Formula:C20H24NO4Purity:Min. 95%Molecular weight:342.4 g/molLaurifoline
CAS:Laurifoline is a potential inhibitor of NF-κB.Formula:C20H24NO4Color and Shape:SolidMolecular weight:342.41




