CymitQuimica logo

CAS 72245-48-8

:

3,3′-[Thiobis(2,1-phenylene-2,1-diazenediyl)]bis[6-hydroxybenzoic acid]

Description:
3,3′-[Thiobis(2,1-phenylene-2,1-diazenediyl)]bis[6-hydroxybenzoic acid], with the CAS number 72245-48-8, is a synthetic organic compound characterized by its complex molecular structure, which includes azo and hydroxyl functional groups. This compound features a thiobis linkage that connects two azo groups, which are known for their vibrant colors and potential applications in dyes and pigments. The presence of hydroxyl groups contributes to its solubility in polar solvents and may enhance its reactivity, making it suitable for various chemical reactions. Additionally, the compound's structure suggests potential applications in fields such as materials science, pharmaceuticals, and dye chemistry due to its ability to form hydrogen bonds and its potential for complexation with metal ions. Its stability, solubility, and reactivity can vary based on environmental conditions, such as pH and temperature, which are important considerations for its practical applications. Overall, this compound exemplifies the intersection of organic chemistry and materials science, with potential uses in diverse applications.
Formula:C26H18N4O6S
InChI:InChI=1S/C26H18N4O6S/c31-21-11-9-15(13-17(21)25(33)34)27-29-19-5-1-3-7-23(19)37-24-8-4-2-6-20(24)30-28-16-10-12-22(32)18(14-16)26(35)36/h1-14,31-32H,(H,33,34)(H,35,36)
InChI key:InChIKey=UAABKYIDUJFPIH-UHFFFAOYSA-N
SMILES:S(C1=C(N=NC2=CC(C(O)=O)=C(O)C=C2)C=CC=C1)C3=C(N=NC4=CC(C(O)=O)=C(O)C=C4)C=CC=C3
Synonyms:
  • Benzoic acid, 3,3′-[thiobis(2,1-phenylene-2,1-diazenediyl)]bis[6-hydroxy-
  • Benzoic acid, 3,3′-[thiobis(2,1-phenyleneazo)]bis[6-hydroxy-
  • 3,3′-[Thiobis(2,1-phenylene-2,1-diazenediyl)]bis[6-hydroxybenzoic acid]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.