CymitQuimica logo

CAS 722491-34-1

:

4-(1-Methylpropyl)-1-piperazineacetic acid

Description:
4-(1-Methylpropyl)-1-piperazineacetic acid, identified by its CAS number 722491-34-1, is a chemical compound that belongs to the class of piperazine derivatives. This substance features a piperazine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms. The presence of the 1-methylpropyl group contributes to its hydrophobic characteristics, while the acetic acid moiety introduces polar functional groups, enhancing its solubility in polar solvents. The compound is likely to exhibit biological activity, potentially interacting with various receptors or enzymes due to its structural features. Its molecular structure suggests that it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric disorders. Additionally, the compound's stability and reactivity can be influenced by the pH of the environment, as the carboxylic acid group can ionize, affecting its overall properties. As with many piperazine derivatives, it may also exhibit a range of pharmacological effects, warranting further investigation into its potential therapeutic uses.
Formula:C10H20N2O2
InChI:InChI=1S/C10H20N2O2/c1-3-9(2)12-6-4-11(5-7-12)8-10(13)14/h9H,3-8H2,1-2H3,(H,13,14)
InChI key:InChIKey=WYBLDIHNGVQSDL-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1CCN(C(CC)C)CC1
Synonyms:
  • 4-(1-Methylpropyl)-1-piperazineacetic acid
  • 1-Piperazineacetic acid, 4-(1-methylpropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.