CAS 722491-35-2

4-Cyclopentyl-1-piperazineacetic acid

Description:

4-Cyclopentyl-1-piperazineacetic acid is a chemical compound characterized by its unique structure, which includes a piperazine ring and a cyclopentyl group. This compound typically exhibits properties associated with both piperazine derivatives and carboxylic acids. It is likely to be a white to off-white solid at room temperature, with moderate solubility in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid functional group. The piperazine moiety may impart basic characteristics, allowing it to interact with various biological targets, which could be of interest in medicinal chemistry. Additionally, the cyclopentyl group may influence its lipophilicity and overall pharmacokinetic profile. As with many piperazine derivatives, this compound may exhibit potential pharmacological activities, making it a candidate for further research in drug development. However, specific biological activities and safety profiles would require empirical studies to establish its efficacy and toxicity.

Formula: C₁₁H₂₀N₂O₂

InChI: InChI=1S/C11H20N2O2/c14-11(15)9-12-5-7-13(8-6-12)10-3-1-2-4-10/h10H,1-9H2,(H,14,15)

InChI key: InChIKey=IMOWUVVOAOUPCS-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1CCN(CC1)C2CCCC2

Synonyms:

• 1-Piperazineacetic acid, 4-cyclopentyl-
• 4-Cyclopentyl-1-piperazineacetic acid