CAS 722491-37-4

[4-(2-cyanoethyl)piperazin-1-yl]acetic acid

Description:

[4-(2-cyanoethyl)piperazin-1-yl]acetic acid is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. This compound features a cyanoethyl group attached to the piperazine nitrogen, contributing to its unique reactivity and potential biological activity. The acetic acid moiety provides acidic properties, allowing for interactions in various chemical environments. It is typically a white to off-white solid and is soluble in polar solvents, which enhances its utility in pharmaceutical applications. The presence of both the cyano and carboxylic acid functional groups suggests potential for hydrogen bonding and nucleophilic reactions, making it a candidate for further chemical modifications. Additionally, its structure may impart specific pharmacological properties, making it of interest in medicinal chemistry. As with many piperazine derivatives, it may exhibit a range of biological activities, including potential use as a drug or in the development of therapeutic agents. Safety and handling precautions should be observed due to its chemical nature and potential biological effects.

Formula: C₉H₁₅N₃O₂

InChI: InChI=1/C9H15N3O2/c10-2-1-3-11-4-6-12(7-5-11)8-9(13)14/h1,3-8H2,(H,13,14)

SMILES: C(C#N)CN1CCN(CC1)CC(=O)O

Synonyms:

• 1-Piperazineacetic acid, 4-(2-cyanoethyl)-
• [4-(2-Cyanoethyl)piperazin-1-yl]acetic acid
• [4-(2-CYANO-ETHYL)-PIPERAZIN-1-YL]-ACETIC ACID
• AKOS BB-5215
• 2-[4-(2-cyanoethyl)-1-piperazinyl]acetic acid
• 4-(2-Cyano-ethyl)-piperazin-1-yl]-

2-[4-(2-Cyanoethyl)piperazin-1-yl]acetic acid

CAS: 722491-37-4

2-[4-(2-Cyanoethyl)piperazin-1-yl]acetic acid

Molecular weight: 197.2343g/mol

Ref: 54-OR1021185

[4-(2-Cyano-ethyl)-piperazin-1-yl]-acetic acid

CAS: 722491-37-4

Formula: C₉H₁₅N₃O₂

Purity: 98.0%

Color and Shape: Solid

Molecular weight: 197.238

Ref: 10-F019931