CAS 722491-60-3
:α-(1,1,2,2,2-Pentafluoroethyl)-2-furanmethanol
Description:
α-(1,1,2,2,2-Pentafluoroethyl)-2-furanmethanol, identified by its CAS number 722491-60-3, is a fluorinated organic compound characterized by the presence of a furan ring and a pentafluoroethyl group. This compound typically exhibits high thermal stability and low volatility due to the strong carbon-fluorine bonds, which contribute to its unique chemical properties. The furan moiety provides potential for reactivity in various organic transformations, while the pentafluoroethyl group enhances lipophilicity and may influence solubility in non-polar solvents. Additionally, the presence of the hydroxymethyl group (–CH2OH) introduces polar characteristics, which can facilitate hydrogen bonding and affect the compound's interaction with biological systems. Overall, this compound's distinctive structure and functional groups suggest potential applications in fields such as pharmaceuticals, agrochemicals, and materials science, where fluorinated compounds are often valued for their stability and unique reactivity profiles.
Formula:C7H5F5O2
InChI:InChI=1S/C7H5F5O2/c8-6(9,7(10,11)12)5(13)4-2-1-3-14-4/h1-3,5,13H
InChI key:InChIKey=FQPMLAVDXFSOFL-UHFFFAOYSA-N
SMILES:C(C(O)C1=CC=CO1)(C(F)(F)F)(F)F
Synonyms:- α-(1,1,2,2,2-Pentafluoroethyl)-2-furanmethanol
- 2-Furanmethanol, α-(1,1,2,2,2-pentafluoroethyl)-
- 2-Furanmethanol, α-(pentafluoroethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
