CymitQuimica logo

CAS 722491-62-5

:

α-(Trifluoromethyl)-3-furanmethanol

Description:
α-(Trifluoromethyl)-3-furanmethanol is a chemical compound characterized by the presence of a furan ring, which is a five-membered aromatic heterocycle containing oxygen. The trifluoromethyl group (-CF3) attached to the α-position of the furan ring significantly influences the compound's chemical properties, including its reactivity and polarity. This compound typically exhibits a high degree of lipophilicity due to the electronegative fluorine atoms, which can enhance its biological activity and stability. The hydroxymethyl group (-CH2OH) at the 3-position contributes to its potential as a versatile intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the presence of the trifluoromethyl group can impart unique electronic properties, making it useful in various applications, including medicinal chemistry and materials science. Overall, α-(Trifluoromethyl)-3-furanmethanol is notable for its distinctive structural features and potential utility in chemical synthesis and research.
Formula:C6H5F3O2
InChI:InChI=1S/C6H5F3O2/c7-6(8,9)5(10)4-1-2-11-3-4/h1-3,5,10H
InChI key:InChIKey=WFXXBPYHFCQFJZ-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(O)C=1C=COC1
Synonyms:
  • α-(Trifluoromethyl)-3-furanmethanol
  • 2,2,2-Trifluoro-1-(furan-3-yl)ethanol
  • 3-Furanmethanol, α-(trifluoromethyl)-
  • 2,2,2-Trifluoro-1-(furan-3-yl)ethan-1-ol
  • 2,2,2-Trifluoro-1-furan-3-yl-ethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.