CAS 72252-96-1

2-(2,5-dioxopyrrolidin-1-yl)-4-[(iodoacetyl)amino]benzoate

Description:

2-(2,5-Dioxopyrrolidin-1-yl)-4-[(iodoacetyl)amino]benzoate, with the CAS number 72252-96-1, is a chemical compound that features a complex structure combining a benzoate moiety with a pyrrolidine derivative. This compound typically exhibits characteristics such as being a solid at room temperature, with potential solubility in organic solvents due to its polar functional groups. The presence of the iodoacetyl group suggests that it may have reactivity towards nucleophiles, making it useful in various synthetic applications. The dioxopyrrolidine component indicates that it may participate in reactions typical of lactams, such as hydrolysis or ring-opening under certain conditions. Additionally, the compound may exhibit biological activity, potentially serving as a pharmacophore in medicinal chemistry. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular conformation. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.

Formula: C₁₃H₁₀IN₂O₅

InChI: InChI=1/C13H11IN2O5/c14-6-10(17)15-7-1-2-8(13(20)21)9(5-7)16-11(18)3-4-12(16)19/h1-2,5H,3-4,6H2,(H,15,17)(H,20,21)/p-1

SMILES: c1cc(c(cc1N=C(CI)[O-])N1C(=O)CCC1=O)C(=O)O

Synonyms:

• Benzoic Acid, 2-(2,5-Dioxo-1-Pyrrolidinyl)-4-[(2-Iodoacetyl)Amino]-, Ion(1-)

N-succinimidyl-4-((iodoacetyl)amino)benzoate

CAS: 72252-96-1

Formula: C₁₃H₁₁IN₂O₅

Purity: 97%

Color and Shape: Solid

Molecular weight: 402.1413

Ref: IN-DA00FCDE

N-Succinimidyl (4-iodoacetyl)aminobenzoate

CAS: 72252-96-1

N-Succinimidyl (4-iodoacetyl)aminobenzoate

Formula: C₁₃H₁₁O₅N₂I

Color and Shape: off-white to tan powder

Molecular weight: 400.13g/mol

Ref: 54-BICL204

N-Succinimidyl (4-Iodoacetyl)aminobenzoate

Controlled Product

CAS: 72252-96-1

Applications A sulfhydryl and amino reactive heterobifunctional protein crosslinking reagent. Spacer Arm: 10.6 Angstroms
References Weltman, J.K., et al.: Biotechniques, 1, 148 (1983)

Formula: C₁₃H₉IN₂O₅

Color and Shape: Neat

Molecular weight: 400.13

Ref: TR-S690300