CAS 722543-31-9
:Barasertib
Description:
Barasertib, also known by its chemical name AZD1152, is a small molecule inhibitor primarily targeting Aurora B kinase, an enzyme involved in cell division. It is classified as an antineoplastic agent, making it relevant in cancer research and treatment. Barasertib exhibits characteristics typical of kinase inhibitors, including the ability to disrupt mitotic processes, leading to cell cycle arrest and apoptosis in cancer cells. Its mechanism of action involves competitive inhibition, which prevents the phosphorylation of target proteins necessary for mitosis. The substance is often studied in the context of various malignancies, particularly those with aberrant Aurora B activity. Barasertib is typically administered in a clinical setting, and its pharmacokinetics include absorption, distribution, metabolism, and excretion profiles that are crucial for determining dosing regimens. Safety and efficacy are evaluated through clinical trials, where side effects and therapeutic outcomes are closely monitored. Overall, Barasertib represents a promising avenue in targeted cancer therapy, particularly for tumors that are resistant to conventional treatments.
Formula:C26H31FN7O6P
InChI:InChI=1S/C26H31FN7O6P/c1-2-34(10-12-40-41(36,37)38)9-4-11-39-21-7-8-22-23(16-21)28-17-29-26(22)31-24-14-20(32-33-24)15-25(35)30-19-6-3-5-18(27)13-19/h3,5-8,13-14,16-17H,2,4,9-12,15H2,1H3,(H,30,35)(H2,36,37,38)(H2,28,29,31,32,33)
InChI key:InChIKey=GBJVVSCPOBPEIT-UHFFFAOYSA-N
SMILES:N(C=1C2=C(C=C(OCCCN(CCOP(=O)(O)O)CC)C=C2)N=CN1)C3=CC(CC(NC4=CC(F)=CC=C4)=O)=NN3
Synonyms:- AZD1152
- Barasertib
- 5-[[7-[3-[Ethyl[2-(phosphonooxy)ethyl]amino]propoxy]-4-quinazolinyl]amino]-N-(3-fluorophenyl)-1H-pyrazole-3-acetamide
- AZD 1152
- 1H-Pyrazole-3-acetamide, 5-[[7-[3-[ethyl[2-(phosphonooxy)ethyl]amino]propoxy]-4-quinazolinyl]amino]-N-(3-fluorophenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-[[7-[3-[ethyl[2-(phosphonooxy)ethyl]amino]propoxy]-4-quinazolinyl]amino]-N-(3-fluorophenyl)-1H-pyrazole-3-acetamide
CAS:Formula:C26H31FN7O6PPurity:98%Molecular weight:587.5398Barasertib
CAS:AZD1152 is a pro-drug of Barasertib (AZD1152)-hQPA. Which is a highly selective Aurora B inhibitor with IC50 of 0.37 nM in a cell-free assay.Formula:C26H31FN7O6PPurity:99.92% - 99.97%Color and Shape:SolidMolecular weight:587.54AZD 1152
CAS:AZD 1152 is an Aurora kinase inhibitor, which is a type of small-molecule therapeutic agent. It is derived from the pharmaceutical research conducted by AstraZeneca. Its primary mode of action involves the selective inhibition of Aurora B kinase, an enzyme crucial for the regulation of mitosis. By interfering with this enzyme, AZD 1152 disrupts the normal progression of cell division, leading to the inhibition of proliferation and induction of apoptosis in rapidly dividing cells.Formula:C26H31FN7O6PPurity:Min. 97 Area-%Color and Shape:Slightly Yellow PowderMolecular weight:587.54 g/mol




