CAS 722544-51-6

2-{3-[(7-{3-[ethyl(2-hydroxyethyl)amino]propoxy}quinazolin-4-yl)amino]-1H-pyrazol-5-yl}-N-(3-fluorophenyl)acetamide

Description:

The chemical substance known as 2-{3-[(7-{3-[ethyl(2-hydroxyethyl)amino]propoxy}quinazolin-4-yl)amino]-1H-pyrazol-5-yl}-N-(3-fluorophenyl)acetamide, with the CAS number 722544-51-6, is a complex organic compound characterized by its multi-functional structure. It features a quinazoline core, which is a bicyclic compound known for its biological activity, particularly in medicinal chemistry. The presence of a pyrazole ring and various substituents, including an ethyl(2-hydroxyethyl)amino group and a 3-fluorophenyl moiety, suggests potential interactions with biological targets, making it a candidate for pharmaceutical applications. The compound's structure indicates it may exhibit properties such as solubility in organic solvents, potential for hydrogen bonding due to the hydroxyl group, and possible reactivity due to the presence of amide and amino functionalities. Its specific characteristics, including melting point, solubility, and biological activity, would require empirical investigation to fully understand its behavior in various environments.

Formula: C₂₆H₃₀FN₇O₃

InChI: InChI=1/C26H30FN7O3/c1-2-34(10-11-35)9-4-12-37-21-7-8-22-23(16-21)28-17-29-26(22)31-24-14-20(32-33-24)15-25(36)30-19-6-3-5-18(27)13-19/h3,5-8,13-14,16-17,35H,2,4,9-12,15H2,1H3,(H,30,36)(H2,28,29,31,32,33)

SMILES: CCN(CCCOc1ccc2c(c1)ncnc2N=c1cc(CC(=Nc2cccc(c2)F)O)[nH][nH]1)CCO

Synonyms:

• Azd-1152Hqpa

AZD1152-HQPA

CAS: 722544-51-6

Formula: C₂₆H₃₀FN₇O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 507.5599

Ref: IN-DA005J37

Barasertib-HQPA

CAS: 722544-51-6

Barasertib-HQPA

Purity: 98%

Molecular weight: 507.56g/mol

Ref: 54-PC108653

Barasertib-HQPA

CAS: 722544-51-6

Barasertib-HQPA

Purity: ≥98%

Molecular weight: 507.56g/mol

Ref: 54-BUP13375

Barasertib-HQPA

CAS: 722544-51-6

Barasertib-HQPA (AZD2811) is a highly selective Aurora B inhibitor (IC50: 0.37 nM) and demonstrates ~3,700-fold greater selectivity than Aurora A.

Formula: C₂₆H₃₀FN₇O₃

Purity: 98.43% - 99.29%

Color and Shape: Solid

Molecular weight: 507.56

Ref: TM-T2602

Barasertib-HQPA

CAS: 722544-51-6

Inhibitor of Aurora B kinase

Formula: C₂₆H₃₀FN₇O₃

Purity: Min. 95%

Molecular weight: 507.56 g/mol

Ref: 3D-FB32080