CAS 722549-98-6

4-(morpholin-4-yl)pyridin-2-amine

Description:

4-(Morpholin-4-yl)pyridin-2-amine, with the CAS number 722549-98-6, is a chemical compound characterized by its pyridine and morpholine functional groups. This compound features a pyridine ring substituted at the 2-position with an amino group and at the 4-position with a morpholine moiety. The presence of the morpholine ring contributes to its potential as a versatile building block in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to engage in hydrogen bonding and its favorable lipophilicity. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. Its structural features suggest potential applications in various biological activities, including as a ligand in receptor interactions or as an intermediate in the synthesis of more complex molecules. Additionally, the presence of both nitrogen-containing heterocycles may influence its pharmacokinetic properties, making it a subject of interest in drug discovery and development.

Formula: C₉H₁₃N₃O

InChI: InChI=1/C9H13N3O/c10-9-7-8(1-2-11-9)12-3-5-13-6-4-12/h1-2,7H,3-6H2,(H2,10,11)

SMILES: c1c[nH]c(=N)cc1N1CCOCC1

Synonyms:

• 2-Pyridinamine, 4-(4-morpholinyl)-

4-Morpholinopyridin-2-amine

CAS: 722549-98-6

Formula: C₉H₁₃N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 179.2190

Ref: IN-DA003GFP

2-Amino-4-(morpholin-4-yl)pyridine

CAS: 722549-98-6

2-Amino-4-(morpholin-4-yl)pyridine

Purity: 99%

Color and Shape: Off-White Solid

Molecular weight: 179.22g/mol

Ref: 54-OR30943

4-Morpholin-4-ylpyridin-2-amine

CAS: 722549-98-6

Formula: C₉H₁₃N₃O

Purity: 97%

Color and Shape: Solid, Off-white crystalline solid

Molecular weight: 179.223

Ref: 10-F064779