CAS 722550-01-8

4-(pyrrolidin-1-yl)pyridin-2-amine

Description:

4-(Pyrrolidin-1-yl)pyridin-2-amine, with the CAS number 722550-01-8, is a chemical compound characterized by its pyridine and pyrrolidine functional groups. This compound features a pyridine ring substituted at the 2-position with an amino group and at the 4-position with a pyrrolidine moiety. It is typically a solid at room temperature and may exhibit properties such as solubility in polar solvents, which is common for amines and heterocyclic compounds. The presence of both nitrogen-containing rings contributes to its potential basicity and reactivity, making it of interest in medicinal chemistry and drug development. The compound may also display biological activity, which can be attributed to its structural features that allow for interactions with biological targets. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be studied for its pharmacological properties or as a building block in the synthesis of more complex molecules.

Formula: C₉H₁₃N₃

InChI: InChI=1/C9H13N3/c10-9-7-8(3-4-11-9)12-5-1-2-6-12/h3-4,7H,1-2,5-6H2,(H2,10,11)

SMILES: C1CCN(C1)c1cc[nH]c(=N)c1

Synonyms:

• 2-Pyridinamine, 4-(1-pyrrolidinyl)-

2-Pyridinamine,4-(1-pyrrolidinyl)-(9CI)

CAS: 722550-01-8

Formula: C₉H₁₃N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 163.2196

Ref: IN-DA003GFY

2-Amino-4-(pyrrolidin-1-yl)pyridine

CAS: 722550-01-8

2-Amino-4-(pyrrolidin-1-yl)pyridine

Formula: C₉H₁₃N₃

Purity: 95%

Color and Shape: yellow solid

Molecular weight: 163.22g/mol

Ref: 54-OR30944

4-Pyrrolidin-1-ylpyridin-2-amine

CAS: 722550-01-8

Formula: C₉H₁₃N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 163.224

Ref: 10-F064782

2-Amino-4-(pyrrolidin-1-yl)pyridine

CAS: 722550-01-8

2-Amino-4-(pyrrolidin-1-yl)pyridine is a reagent used in the 1,3-dipolar cycloaddition reaction with an electron donor such as an ether or enol ether. It has been shown to be useful in the synthesis of imidazopyridines and cyclocondensation reactions. This compound can also be used for the synthesis of heterocycles by coupling two different molecules together.

Formula: C₉H₁₃N₃

Purity: Min. 95%

Molecular weight: 163.22 g/mol

Ref: 3D-XDB55001