CAS 7226-33-7

2-deoxy-2-fluoro-D-ribose

Description:

2-Deoxy-2-fluoro-D-ribose is a modified sugar that belongs to the class of ribonucleosides, specifically a derivative of ribose where the hydroxyl group at the second carbon is replaced by a fluorine atom. This modification imparts unique properties to the molecule, making it of interest in various biochemical and pharmaceutical applications. The presence of the fluorine atom can enhance the stability of nucleotides and nucleic acids, potentially improving their resistance to enzymatic degradation. 2-Deoxy-2-fluoro-D-ribose is often utilized in the synthesis of nucleoside analogs, which can serve as antiviral or anticancer agents. Its structural characteristics include a five-membered furanose ring, typical of ribose sugars, and it retains the essential hydroxyl groups at the other carbons, which are crucial for biological activity. The compound is typically white to off-white in appearance and is soluble in water, making it suitable for various laboratory applications. Overall, 2-deoxy-2-fluoro-D-ribose represents a significant tool in the field of medicinal chemistry and molecular biology.

Formula: C₅H₉FO₄

InChI: InChI=1/C5H9FO4/c6-3(1-7)5(10)4(9)2-8/h1,3-5,8-10H,2H2/t3-,4+,5-/m0/s1

Synonyms:

• D-Ribose, 2-deoxy-2-fluoro-

2-Deoxy-2-fluoro-D-ribofuranose

CAS: 7226-33-7

2-Deoxy-2-fluoro-D-ribofuranose is a dinucleoside that stabilizes the ribose moiety of uridine and guanosine, which are important for bacterial DNA replication. 2-Deoxy-2-fluoro-D-ribofuranose binds to the ribosomal enzyme Uridylate Kinase and inhibits its activity, thereby preventing the synthesis of nucleotide precursors. This product has been shown to be effective against bacteria such as Escherichia coli and Staphylococcus aureus. The hydration properties of 2-deoxy -2 fluorodeoxy D ribofuranose make it an ideal ligand for binding to enzymes in order to inhibit their function. The nature of this compound also makes it an ideal candidate for thermodynamic studies.

Formula: C₅H₉FO₄

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 152.12 g/mol

Ref: 3D-MD03815

2-Deoxy-2-fluoro-D-ribofuranose

Controlled Product

CAS: 7226-33-7

Formula: C₅H₉FO₄

Color and Shape: Neat

Molecular weight: 152.121

Ref: TR-D236303