CymitQuimica logo

CAS 72261-78-0

:

N,2,4,6-tetramethylbenzamide

Description:
N,2,4,6-tetramethylbenzamide is an organic compound characterized by its amide functional group attached to a benzene ring that has four methyl groups substituted at the 2, 4, and 6 positions. This structure contributes to its unique properties, including increased steric hindrance and altered electronic characteristics compared to unsubstituted benzamides. The presence of multiple methyl groups enhances its lipophilicity, potentially affecting its solubility in organic solvents. The compound is typically a solid at room temperature and may exhibit a relatively high melting point due to the strong intermolecular forces associated with the amide group. N,2,4,6-tetramethylbenzamide can be utilized in various chemical applications, including as a reagent in organic synthesis or as a potential intermediate in the production of pharmaceuticals. Its specific reactivity and stability can be influenced by the steric effects of the methyl groups, making it an interesting subject for studies in organic chemistry and materials science. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C11H15NO
InChI:InChI=1/C11H15NO/c1-7-5-8(2)10(9(3)6-7)11(13)12-4/h5-6H,1-4H3,(H,12,13)
SMILES:Cc1cc(C)c(c(C)c1)C(=NC)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.