CAS 72269-24-0

N-(4-Acetylphenyl)-4-methylbenzamide

Description:

N-(4-Acetylphenyl)-4-methylbenzamide, with the CAS number 72269-24-0, is an organic compound characterized by its amide functional group. It features a phenyl ring substituted with an acetyl group at one position and a methyl group at another, contributing to its structural complexity. This compound typically appears as a solid at room temperature and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water due to its hydrophobic aromatic components. The presence of the acetyl and methyl groups influences its chemical reactivity and potential applications, which may include use in pharmaceuticals or as an intermediate in organic synthesis. Its molecular structure suggests potential for interactions such as hydrogen bonding, which can affect its physical properties and behavior in various chemical environments. As with many organic compounds, safety data should be consulted for handling and storage, as it may pose health risks if ingested or inhaled.

Formula: C₁₆H₁₅NO₂

InChI: InChI=1S/C16H15NO2/c1-11-3-5-14(6-4-11)16(19)17-15-9-7-13(8-10-15)12(2)18/h3-10H,1-2H3,(H,17,19)

InChI key: InChIKey=WIFHKFKUUAUAKR-UHFFFAOYSA-N

SMILES: C(NC1=CC=C(C(C)=O)C=C1)(=O)C2=CC=C(C)C=C2

Synonyms:

• N-(4-Acetylphenyl)-4-methylbenzamide
• Benzamide, N-(4-acetylphenyl)-4-methyl-