CAS 72269-25-1

N-(4-Acetylphenyl)-4-methoxybenzamide

Description:

N-(4-Acetylphenyl)-4-methoxybenzamide, identified by its CAS number 72269-25-1, is an organic compound characterized by its amide functional group, which is formed from the reaction of an amine and a carboxylic acid. This compound features a phenyl ring substituted with an acetyl group at one position and a methoxy group at another, contributing to its unique chemical properties. The presence of the acetyl group enhances its reactivity and potential applications in organic synthesis, while the methoxy group can influence its solubility and polarity. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, N-(4-Acetylphenyl)-4-methoxybenzamide represents a versatile compound with potential utility in various chemical and biological contexts.

Formula: C₁₆H₁₅NO₃

InChI: InChI=1S/C16H15NO3/c1-11(18)12-3-7-14(8-4-12)17-16(19)13-5-9-15(20-2)10-6-13/h3-10H,1-2H3,(H,17,19)

InChI key: InChIKey=OZBJBHMULRQFKG-UHFFFAOYSA-N

SMILES: N(C(=O)C1=CC=C(OC)C=C1)C2=CC=C(C(C)=O)C=C2

Synonyms:

• N-(4-Acetylphenyl)-4-methoxybenzamide
• STX 1468
• Benzamide, N-(4-acetylphenyl)-4-methoxy-