CymitQuimica logo

CAS 72269-94-4

:

N2-Cyclohexyl-N2-methyl-1,3,4-thiadiazole-2,5-diamine

Description:
N2-Cyclohexyl-N2-methyl-1,3,4-thiadiazole-2,5-diamine, with CAS number 72269-94-4, is a chemical compound characterized by its unique thiadiazole structure, which incorporates both nitrogen and sulfur atoms in a five-membered ring. This compound features two amine groups, contributing to its potential reactivity and ability to form hydrogen bonds. The cyclohexyl and methyl substituents enhance its lipophilicity, which may influence its solubility and biological activity. Thiadiazoles are known for their diverse applications, including in pharmaceuticals and agrochemicals, due to their ability to interact with biological systems. The presence of the thiadiazole ring may impart specific electronic properties, making it a candidate for various chemical reactions. Additionally, the compound's stability and reactivity can be influenced by the steric effects of the cyclohexyl group and the electronic effects of the amine functionalities. Overall, N2-Cyclohexyl-N2-methyl-1,3,4-thiadiazole-2,5-diamine represents a class of compounds with potential utility in medicinal chemistry and materials science.
Formula:C9H16N4S
InChI:InChI=1S/C9H16N4S/c1-13(7-5-3-2-4-6-7)9-12-11-8(10)14-9/h7H,2-6H2,1H3,(H2,10,11)
InChI key:InChIKey=VBEHGFJVPHWMIR-UHFFFAOYSA-N
SMILES:N(C)(C=1SC(N)=NN1)C2CCCCC2
Synonyms:
  • 2-N-Cyclohexyl-2-N-methyl-1,3,4-thiadiazole-2,5-diamine
  • 1,3,4-Thiadiazole-2,5-diamine, N2-cyclohexyl-N2-methyl-
  • 1,3,4-Thiadiazole-2,5-diamine, N-cyclohexyl-N-methyl-
  • N2-Cyclohexyl-N2-methyl-1,3,4-thiadiazole-2,5-diamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.