CAS 72271-71-7

4-(4-butylphenyl)-4-oxobutanoic acid

Description:

4-(4-butylphenyl)-4-oxobutanoic acid, with the CAS number 72271-71-7, is an organic compound characterized by its structure, which includes a butyl group attached to a phenyl ring and a ketone functional group adjacent to a carboxylic acid. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in various fields, including pharmaceuticals and materials science. The presence of the butyl group enhances its hydrophobic characteristics, while the carboxylic acid group provides acidity and potential for hydrogen bonding. This dual nature can influence its solubility in different solvents, making it more soluble in organic solvents than in water. Additionally, the compound may exhibit interesting thermal and chemical stability, which can be relevant in synthetic applications. Overall, 4-(4-butylphenyl)-4-oxobutanoic acid is a versatile compound with properties that can be tailored for specific uses in chemical synthesis and formulation.

Formula: C₁₄H₁₈O₃

InChI: InChI=1/C14H18O3/c1-2-3-4-11-5-7-12(8-6-11)13(15)9-10-14(16)17/h5-8H,2-4,9-10H2,1H3,(H,16,17)

SMILES: CCCCc1ccc(cc1)C(=O)CCC(=O)O

Synonyms:

• Benzenebutanoic acid, 4-butyl-gamma-oxo-

4-(4-Butylphenyl)-4-oxobutanoic acid

CAS: 72271-71-7

Formula: C₁₄H₁₈O₃

Color and Shape: Solid

Molecular weight: 234.2909

Ref: IN-DA00FB71

4-(4-n-Butylphenyl)-4-oxobutyric acid

CAS: 72271-71-7

Formula: C₁₄H₁₈O₃

Purity: 95.0%

Molecular weight: 234.295

Ref: 10-F022995