CAS 72287-77-5

N,N-dimethylglycinamide hydrochloride

Description:

N,N-Dimethylglycinamide hydrochloride is a chemical compound characterized by its structure, which includes a dimethylated amino group and a glycinamide moiety. It is a white to off-white crystalline powder that is soluble in water and exhibits hygroscopic properties. This compound is often used in biochemical research and pharmaceutical applications due to its role as a potential metabolic intermediate and its involvement in various biological processes. The hydrochloride salt form enhances its solubility and stability, making it suitable for various formulations. N,N-Dimethylglycinamide hydrochloride is known for its low toxicity and is generally considered safe for use in laboratory settings. Its molecular formula reflects the presence of nitrogen, carbon, hydrogen, and chlorine, contributing to its unique chemical behavior. As with many compounds, proper handling and storage conditions are essential to maintain its integrity and effectiveness in applications.

Formula: C₄H₁₁ClN₂O

InChI: InChI=1/C4H10N2O.ClH/c1-6(2)4(7)3-5;/h3,5H2,1-2H3;1H

SMILES: CN(C)C(=O)CN.Cl

Synonyms:

• acetamide, 2-amino-N,N-dimethyl-, hydrochloride (1:1)
• N,N-Dimethylglycinamide hydrochloride (1:1)2-Amino-N,N-dimethyl-acetamide HCl

2-Amino-n,n-dimethylacetamide, HCl

CAS: 72287-77-5

Formula: C₄H₁₁ClN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 138.5959

Ref: IN-DA0036O7

2-Amino-N,N-dimethylacetamide hydrochloride

CAS: 72287-77-5

2-Amino-N,N-dimethylacetamide hydrochloride

Formula: C₄H₁₀N₂O·ClH

Purity: 97%

Color and Shape: Powder

Molecular weight: 138.59594g/mol

Ref: 54-OR12015

2-Amino-N,N-dimethylacetamide hydrochloride

CAS: 72287-77-5

Formula: C₄H₁₁ClN₂O

Purity: 95%

Color and Shape: White powder

Molecular weight: 138.6

Ref: 10-F092886