CAS 7229-50-7
:Streptolydigin
Description:
Streptolydigin is a naturally occurring antibiotic produced by the bacterium *Streptomyces griseus*. It is primarily known for its ability to inhibit RNA polymerase, which is crucial for bacterial transcription, thereby exhibiting potent antibacterial properties. The compound is characterized by its complex structure, which includes a fused bicyclic system and various functional groups that contribute to its biological activity. Streptolydigin is particularly effective against Gram-positive bacteria and has been studied for its potential therapeutic applications. Its mechanism of action involves binding to the RNA polymerase enzyme, preventing the synthesis of RNA and ultimately leading to bacterial cell death. Due to its specific target, it has garnered interest in the field of antibiotic research, especially in the context of combating antibiotic resistance. However, like many antibiotics, its use may be limited by potential side effects and the development of resistance in bacterial populations. Overall, streptolydigin represents an important compound in the study of antimicrobial agents and their mechanisms of action.
Formula:C32H44N2O9
InChI:InChI=1S/C32H44N2O9/c1-16(14-17(2)28-18(3)23-12-13-32(15-40-32)31(6,42-23)43-28)8-9-22(36)25-27(37)26(19(4)29(38)33-7)34(30(25)39)24-11-10-21(35)20(5)41-24/h8-9,12-14,17-21,23-24,26,28,35-36H,10-11,15H2,1-7H3,(H,33,38)/b9-8+,16-14+,25-22+/t17-,18+,19+,20+,21+,23-,24+,26+,28-,31-,32-/m1/s1
InChI key:InChIKey=KVTPRMVXYZKLIG-NCAOFHFGSA-N
SMILES:C[C@@]12[C@]3(CO3)C=C[C@@](O1)([C@H](C)[C@@]([C@@H](/C=C(/C=C/C(/O)=C/4\C(=O)N([C@@]([C@@H](C(NC)=O)C)(C4=O)[H])[C@H]5O[C@@H](C)[C@@H](O)CC5)\C)C)(O2)[H])[H]
Synonyms:- 2-Pyrrolidineacetamide, 4-[(2E,4E,6R)-6-[(1R,2′R,3R,4S,5R)-1,4-dimethylspiro[2,9-dioxabicyclo[3.3.1]non-6-ene-8,2′-oxiran]-3-yl]-1-hydroxy-4-methyl-2,4-heptadien-1-ylidene]-N,α-dimethyl-3,5-dioxo-1-[(2S,5S,6S)-tetrahydro-5-hydroxy-6-methyl-2H-pyran-2-yl]-, (αS,2S,4E)-
- 3-Pyrroline-2-acetamide, 4-[6-(1,4-dimethylspiro[2,9-dioxabicyclo[3.3.1]non-6-ene-8,2′-oxiran]-3-yl)-4-methyl-2,4-heptadienoyl]-3-hydroxy-N,α-dimethyl-5-oxo-1-(tetrahydro-5-hydroxy-6-methyl-2H-pyran-2-yl)-
- (αS,2S,4E)-4-[(2E,4E,6R)-6-[(1R,2′R,3R,4S,5R)-1,4-Dimethylspiro[2,9-dioxabicyclo[3.3.1]non-6-ene-8,2′-oxiran]-3-yl]-1-hydroxy-4-methyl-2,4-heptadien-1-ylidene]-N,α-dimethyl-3,5-dioxo-1-[(2S,5S,6S)-tetrahydro-5-hydroxy-6-methyl-2H-pyran-2-yl]-2-pyrrolidineacetamide
- 2-Pyrrolidineacetamide, 4-[(2E,4E,6R)-6-[(1R,2′R,3R,4S,5R)-1,4-dimethylspiro[2,9-dioxabicyclo[3.3.1]non-6-ene-8,2′-oxiran]-3-yl]-1-hydroxy-4-methyl-2,4-heptadienylidene]-N,α-dimethyl-3,5-dioxo-1-[(2S,5S,6S)-tetrahydro-5-hydroxy-6-methyl-2H-pyran-2-yl]-, (αS,2S,4E)-
- Streptolydigin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Streptolydigin
CAS:Streptolydigin inhibits RNA synthesis by binding to RNA polymerase and does not inhibit eukaryotic RNA polymerases.Formula:C32H44N2O9Purity:98%Color and Shape:SolidMolecular weight:600.70Streptolydigin
CAS:Streptolydigin is a peptide that binds to and inhibits the activity of an enzyme called protein kinase C. This enzyme is involved in the regulation of various cellular functions, including gene expression, ion channel activity, and cell motility. Streptolydigin is used as a research tool to study the function of protein kinase C in cells. It can also be used as an antibody to detect this enzyme in tissue sections or to identify its location in cells by immunofluorescence.Formula:C32H44N2O9Purity:Min. 95%Molecular weight:600.7 g/mol

