CAS 72297-05-3
:benzo[pqr]tetraphen-7-amine
Description:
Benzo[pqr]tetraphen-7-amine, identified by its CAS number 72297-05-3, is a polycyclic aromatic compound characterized by its complex structure, which includes multiple phenyl groups fused to a central benzo ring system. This compound typically exhibits properties common to polycyclic aromatic hydrocarbons, such as high stability and potential fluorescence. Its molecular structure contributes to its electronic properties, making it of interest in organic electronics and materials science. The presence of the amine functional group can influence its reactivity and solubility, potentially allowing for interactions with various chemical species. Additionally, compounds like benzo[pqr]tetraphen-7-amine may exhibit interesting photophysical properties, which can be harnessed in applications such as organic light-emitting diodes (OLEDs) or as dyes in various chemical processes. However, due to the complexity of its structure, detailed studies are often required to fully understand its behavior in different environments and applications. Safety and handling precautions should be observed, as with many organic compounds, to mitigate any potential health risks.
Formula:C20H13N
InChI:InChI=1/C20H13N/c21-18-6-2-5-15-16-10-9-13-4-1-3-12-7-8-14(11-17(15)18)20(16)19(12)13/h1-11H,21H2
InChI key:InChIKey=CYLGRLTVDYSTRG-UHFFFAOYSA-N
SMILES:c1cc2ccc3cc4c(cccc4N)c4ccc(c1)c2c34
Synonyms:- Benzo[a]pyren-7-amine
- Benzo[a]pyrene, 7-amino
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
7-Aminobenzo[a]pyrene
CAS:Controlled ProductApplications 7-Aminobenzo[a]pyrene (cas# 72297-05-3) is a compound useful in organic synthesis.
Formula:C20H13NColor and Shape:NeatMolecular weight:267.32
