CymitQuimica logo

CAS 72299-62-8

:

1,2,3,4-Tetrahydro-7-iodoisoquinoline

Description:
1,2,3,4-Tetrahydro-7-iodoisoquinoline is a chemical compound characterized by its bicyclic structure, which includes a saturated tetrahydroisoquinoline framework with an iodine substituent at the 7-position. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. The presence of the iodine atom can influence its reactivity and interactions with biological targets, potentially enhancing its lipophilicity and altering its pharmacokinetic properties. As a derivative of isoquinoline, it may exhibit properties associated with alkaloids, including effects on the central nervous system. The compound's synthesis and characterization involve standard organic chemistry techniques, and it may serve as a precursor or intermediate in the development of more complex pharmaceuticals. Safety data should be consulted for handling, as iodine-containing compounds can pose specific health risks.
Formula:C9H10IN
InChI:InChI=1S/C9H10IN/c10-9-2-1-7-3-4-11-6-8(7)5-9/h1-2,5,11H,3-4,6H2
InChI key:InChIKey=FFCFXJXBXUOFIU-UHFFFAOYSA-N
SMILES:IC=1C=C2C(=CC1)CCNC2
Synonyms:
  • 1,2,3,4-Tetrahydro-7-iodoisoquinoline
  • Isoquinoline, 1,2,3,4-tetrahydro-7-iodo-
  • 7-Iodo-1,2,3,4-tetrahydroisoquinoline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.