CAS 723-09-1

(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetic acid

Description:

(2,5-Dioxo-4,4-dipropylimidazolidin-1-yl)acetic acid, with the CAS number 723-09-1, is a chemical compound characterized by its imidazolidine structure, which includes two carbonyl groups (dioxo) and a propyl substitution at the 4-position. This compound features an acetic acid moiety, contributing to its acidic properties. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the carboxylic acid group. The imidazolidine ring provides stability and can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Its unique structure may impart specific biological activities, making it of interest in pharmaceutical and biochemical research. Additionally, the presence of the dipropyl groups can influence its lipophilicity and overall reactivity. As with many organic compounds, safety precautions should be observed when handling this substance, including the use of appropriate personal protective equipment.

Formula: C₁₁H₁₈N₂O₄

InChI: InChI=1/C11H18N2O4/c1-3-5-11(6-4-2)9(16)13(7-8(14)15)10(17)12-11/h3-7H2,1-2H3,(H,12,17)(H,14,15)

SMILES: CCCC1(CCC)C(=O)N(CC(=O)O)C(=N1)O

2-(2,5-Dioxo-4,4-dipropylimidazolidin-1-yl)acetic acid

CAS: 723-09-1

Versatile small molecule scaffold

Formula: C₁₁H₁₈N₂O₄

Purity: Min. 95%

Molecular weight: 242.27 g/mol

Ref: 3D-AAA72309