CymitQuimica logo

CAS 723-64-8

:

6,6,7,7-Tetrafluoro-3-oxabicyclo[3.2.0]heptane-2,4-dicarboxylic acid

Description:
6,6,7,7-Tetrafluoro-3-oxabicyclo[3.2.0]heptane-2,4-dicarboxylic acid, with CAS number 723-64-8, is a fluorinated organic compound characterized by its bicyclic structure, which includes a fused ring system and two carboxylic acid functional groups. The presence of four fluorine atoms significantly influences its chemical properties, enhancing its stability and lipophilicity while also imparting unique reactivity patterns. This compound is typically colorless to pale yellow and may exhibit a crystalline or solid form. Its fluorinated nature makes it of interest in various applications, including pharmaceuticals, agrochemicals, and materials science, particularly in the development of fluorinated polymers and surfactants. The dicarboxylic acid functionality allows for potential interactions with other chemical species, making it versatile in synthetic chemistry. Additionally, the compound's unique bicyclic structure may contribute to specific biological activities, warranting further investigation in medicinal chemistry. Overall, 6,6,7,7-Tetrafluoro-3-oxabicyclo[3.2.0]heptane-2,4-dicarboxylic acid represents a significant compound in the realm of fluorinated chemicals.
Formula:C8H6F4O5
InChI:InChI=1S/C8H6F4O5/c9-7(10)1-2(8(7,11)12)4(6(15)16)17-3(1)5(13)14/h1-4H,(H,13,14)(H,15,16)
InChI key:InChIKey=ZBYYITGKQLENSW-UHFFFAOYSA-N
SMILES:FC1(F)C2C(C1(F)F)C(C(O)=O)OC2C(O)=O
Synonyms:
  • 3-Oxabicyclo[3.2.0]heptane-2,4-dicarboxylic acid, 6,6,7,7-tetrafluoro-
  • 6,6,7,7-Tetrafluoro-3-oxabicyclo[3.2.0]heptane-2,4-dicarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.