CAS 72315-45-8

1,3-dibromoimidazo[1,5-a]pyridine

Description:

1,3-Dibromoimidazo[1,5-a]pyridine is a heterocyclic organic compound characterized by its imidazole and pyridine rings, which contribute to its unique chemical properties. This compound features two bromine atoms attached to the 1 and 3 positions of the imidazo ring, enhancing its reactivity and potential applications in various chemical reactions. It typically appears as a solid at room temperature and is soluble in organic solvents. The presence of bromine atoms can facilitate electrophilic substitution reactions, making it useful in synthetic organic chemistry. Additionally, the imidazo and pyridine moieties may impart biological activity, suggesting potential applications in pharmaceuticals or agrochemicals. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in different environments. As with many brominated compounds, safety precautions should be taken due to potential toxicity and environmental concerns associated with bromine-containing substances. Overall, 1,3-dibromoimidazo[1,5-a]pyridine is a versatile compound with significant implications in research and industry.

Formula: C₇H₄Br₂N₂

InChI: InChI=1/C7H4Br2N2/c8-6-5-3-1-2-4-11(5)7(9)10-6/h1-4H

SMILES: c1ccn2c(c1)c(Br)nc2Br

Synonyms:

• 1,3-Dibromimidazo[1,5-a]pyridin
• Imidazo[1,5-A]Pyridine, 1,3-Dibromo-

1,3-Dibromoimidazo[1,5-a]pyridine

CAS: 72315-45-8

Formula: C₇H₄Br₂N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 275.9281

Ref: IN-DA005U9Q

1,3-Dibromoimidazo[1,5-a]pyridine

CAS: 72315-45-8

1,3-Dibromoimidazo[1,5-a]pyridine

Purity: 98%

Molecular weight: 275.92806g/mol

Ref: 54-OR94022

1,3-Dibromoimidazo[1,5-a]pyridine

CAS: 72315-45-8

Formula: C₇H₄Br₂N₂

Purity: 98%

Molecular weight: 275.931

Ref: 10-F054228