CAS 72318-55-9

methyl 3-amino-2-(5-methoxy-1H-indol-3-yl)propanoate hydrochloride (1:1)

Description:

Methyl 3-amino-2-(5-methoxy-1H-indol-3-yl)propanoate hydrochloride is a chemical compound characterized by its complex structure, which includes an indole moiety, an amino group, and an ester functional group. This compound is typically a white to off-white crystalline solid, soluble in water and organic solvents, which is common for many hydrochloride salts. The presence of the methoxy group enhances its lipophilicity, potentially influencing its biological activity. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. The compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific interactions and effects would depend on its molecular structure and the biological systems it interacts with. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₃H₁₇ClN₂O₃

InChI: InChI=1/C13H16N2O3.ClH/c1-17-8-3-4-12-9(5-8)11(7-15-12)10(6-14)13(16)18-2;/h3-5,7,10,15H,6,14H2,1-2H3;1H

SMILES: COc1ccc2c(c1)c(c[nH]2)C(CN)C(=O)OC.Cl

Synonyms:

• 1H-indole-3-acetic acid, alpha-(aminomethyl)-5-methoxy-, methyl ester, hydrochloride (1:1)
• Methyl alpha-(aminomethyl)-5-methoxy-1H-indole-3-acetate monohydrochloride

Indorenate Hydrochloride

Controlled Product

CAS: 72318-55-9

Formula: C₁₃H₁₆N₂O₃·ClH

Color and Shape: Neat

Molecular weight: 284.739

Ref: TR-I646505