CAS 72320-59-3
:2-(4-ethylpiperazin-1-yl)-4-phenylquinoline dihydrochloride
Description:
2-(4-Ethylpiperazin-1-yl)-4-phenylquinoline dihydrochloride is a chemical compound characterized by its complex structure, which includes a quinoline core substituted with a phenyl group and a piperazine moiety. This compound typically appears as a dihydrochloride salt, enhancing its solubility in aqueous solutions. It is often studied for its potential biological activities, including antimicrobial and antitumor properties, due to the presence of the quinoline and piperazine functionalities, which are known to exhibit various pharmacological effects. The compound's molecular structure allows for interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its dihydrochloride form indicates the presence of two hydrochloric acid molecules, which can influence its stability and reactivity. As with many organic compounds, handling should be done with care, considering safety protocols due to potential toxicity or reactivity. Overall, this compound represents a significant area of research in drug development and therapeutic applications.
Formula:C21H25Cl2N3
InChI:InChI=1/C21H23N3.2ClH/c1-2-23-12-14-24(15-13-23)21-16-19(17-8-4-3-5-9-17)18-10-6-7-11-20(18)22-21;;/h3-11,16H,2,12-15H2,1H3;2*1H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
AD 1308
CAS:<p>AD 1308 is a bioactive chemical.</p>Formula:C21H23N3Color and Shape:SolidMolecular weight:317.436
