CymitQuimica logo

CAS 723262-95-1

:

(5S)-6,6-dimethyl-5-phenyl-5,6-dihydro-2H-1,4-oxazin-2-one

Description:
(5S)-6,6-dimethyl-5-phenyl-5,6-dihydro-2H-1,4-oxazin-2-one is a chemical compound characterized by its unique oxazine ring structure, which incorporates both nitrogen and oxygen atoms. This compound features a chiral center, indicated by the (5S) designation, which contributes to its stereochemistry and potential biological activity. The presence of the dimethyl and phenyl groups enhances its lipophilicity, potentially influencing its solubility and interaction with biological membranes. The oxazinone moiety suggests that it may exhibit reactivity typical of lactams, possibly participating in nucleophilic attacks or cyclization reactions. This compound may be of interest in medicinal chemistry due to its structural features, which could lead to the development of novel pharmaceuticals. Additionally, its specific CAS number, 723262-95-1, allows for precise identification and retrieval of information regarding its properties, synthesis, and applications in scientific literature. Overall, the compound's structural complexity and functional groups suggest a range of potential applications in organic synthesis and drug development.
Formula:C12H13NO2
InChI:InChI=1/C12H13NO2/c1-12(2)11(13-8-10(14)15-12)9-6-4-3-5-7-9/h3-8,11H,1-2H3/t11-/m0/s1
SMILES:CC1(C)[C@H](c2ccccc2)N=CC(=O)O1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.